CAS 67808-64-4
:5-Formylthiophene-2-carboxylic acid methyl ester
Description:
5-Formylthiophene-2-carboxylic acid methyl ester is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a formyl group (-CHO) and a carboxylic acid methyl ester group (-COOCH3) attached to the thiophene ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the formyl group allows for further functionalization, making it a versatile intermediate in the synthesis of various organic compounds. The methyl ester group enhances its solubility in organic solvents, facilitating its use in chemical reactions. This compound may exhibit properties typical of thiophene derivatives, such as electronic delocalization, which can influence its reactivity and interaction with other chemical species. Additionally, it may have applications in materials science, pharmaceuticals, or as a building block in the synthesis of more complex molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H6O3S
InChI:InChI=1/C7H6O3S/c1-10-7(9)6-3-2-5(4-8)11-6/h2-4H,1H3
SMILES:COC(=O)c1ccc(C=O)s1
Synonyms:- 2-Thiophenecarboxylic Acid, 5-Formyl-, Methyl Ester
- 5-Formyl-2-thiophenecarboxylic acid methyl ester
- Methyl 5-formylthiophene-2-carboxylate
- T5Sj Bvh Evo1 [Wln]
- Methyl 5-formyl-2-thiophenecarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 5-formylthiophene-2-carboxylate
CAS:Formula:C7H6O3SPurity:95%Color and Shape:SolidMolecular weight:170.18575-Formylthiophene-2-carboxylic acid methyl ester
CAS:5-Formylthiophene-2-carboxylic acid methyl esterFormula:C7H6O3SPurity:97%Color and Shape: off white to faint brown crystalline solidMolecular weight:170.19g/mol5-Formylthiophene-2-carboxylic acid methyl ester
CAS:Formula:C7H6O3SPurity:95%Color and Shape:SolidMolecular weight:170.18
