CAS 67808-66-6
:3-Thiophenecarboxylic acid, 5-formyl-, methyl ester
Description:
3-Thiophenecarboxylic acid, 5-formyl-, methyl ester, with the CAS number 67808-66-6, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group and an aldehyde group, contributing to its reactivity and potential applications in organic synthesis. The methyl ester form indicates that the carboxylic acid is esterified with methanol, enhancing its solubility in organic solvents and making it more amenable to various chemical reactions. The presence of both the formyl and carboxylic acid groups suggests that it can participate in condensation reactions, making it useful in the synthesis of more complex molecules. Additionally, the thiophene moiety can impart unique electronic properties, making this compound of interest in materials science and medicinal chemistry. Its characteristics, including melting point, boiling point, and solubility, would typically be determined through experimental methods, as they can vary based on purity and environmental conditions.
Formula:C7H6O3S
InChI:InChI=1S/C7H6O3S/c1-10-7(9)5-2-6(3-8)11-4-5/h2-4H,1H3
InChI key:InChIKey=GNXNZRYWBFMVHK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(C=O)SC1
Synonyms:- (5-Formyl-3-Thienyl) Acetate
- 2-Formylthiophene-4-carboxylic acid methyl ester
- 3-Methoxycarbonyl-thiophene-5-carboxaldehyde
- 3-Thiophenecarboxylic acid, 5-formyl-, methyl ester
- 5-Formylthiophene-3-carboxylic acid methyl ester
- Methyl 2-Formyl-4-Thiophene Carboxylate
- Methyl 2-formyl-4-thiophenecarboxylate
- Methyl 5-Formylthiophene-3-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Thiophenecarboxylic acid, 5-formyl-, methyl ester
CAS:Formula:C7H6O3SPurity:95%Color and Shape:SolidMolecular weight:170.1857Methyl 2-formylthiophene-4-carboxylate
CAS:Methyl 2-formylthiophene-4-carboxylatePurity:98%Molecular weight:170.19g/molMethyl-2-formyl-4-thiophenecarboxylate
CAS:Methyl-2-formyl-4-thiophenecarboxylate is a high quality reagent that is useful as an intermediate in the synthesis of complex compounds. It has a CAS number of 67808-66-6 and can be used as a building block in the synthesis of biologically active molecules. Methyl-2-formyl-4-thiophenecarboxylate is also a versatile building block that can be used to synthesize speciality chemicals, such as research chemicals and reaction components. This chemical has been shown to have many uses in organic synthesis, including being used for the preparation of pharmaceuticals. Methyl 2 formyl 4 thiophenecarboxylate is also useful for the production of fine chemicals, such as dyes and fragrances.Formula:C7H6O3SPurity:Min. 95%Color and Shape:PowderMolecular weight:170.19 g/molMethyl 5-Formylthiophene-3-carboxylate
CAS:Formula:C7H6O3SPurity:95%Color and Shape:SolidMolecular weight:170.18



