CAS 67815-57-0
:1,2,3,5-tetrafluoro-4,6-diiodobenzene
Description:
1,2,3,5-Tetrafluoro-4,6-diiodobenzene is a halogenated aromatic compound characterized by the presence of four fluorine atoms and two iodine atoms attached to a benzene ring. This compound features a highly substituted aromatic system, which influences its physical and chemical properties. The presence of electronegative halogens, particularly fluorine and iodine, contributes to its reactivity and polarity, making it useful in various chemical applications, including as an intermediate in organic synthesis and in materials science. The fluorine atoms enhance the compound's thermal stability and resistance to chemical degradation, while the iodine atoms can facilitate further reactions, such as nucleophilic substitutions. Additionally, the compound's unique structure may impart specific electronic properties, making it of interest in the development of electronic materials or pharmaceuticals. Due to its halogen content, it may also exhibit distinct solubility characteristics in organic solvents. Safety and handling precautions are essential, as halogenated compounds can pose environmental and health risks.
Formula:C6F4I2
InChI:InChI=1/C6F4I2/c7-1-2(8)5(11)4(10)6(12)3(1)9
SMILES:c1(c(c(c(c(c1F)I)F)I)F)F
Synonyms:- 1,3,4,5-Tetrafluoro-2,6-Diiodobenzene
- 1,3-Diiodotetrafluorobenzene
- M-Diiodoperfluorobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Benzene, 1,2,3,5-tetrafluoro-4,6-diiodo-
CAS:Formula:C6F4I2Purity:95%Color and Shape:LiquidMolecular weight:401.86681,3-Diiodotetrafluorobenzene
CAS:<p>1,3-Diiodotetrafluorobenzene</p>Formula:C6F4I2Purity:97%Color and Shape: white slush solidMolecular weight:401.86675g/mol1,3-Diiodotetrafluorobenzene
CAS:<p>1,3-Diiodotetrafluorobenzene is a molecule that is structurally related to 1,3-difluorobenzene and 1,2-diiodoethane. It has been synthesized by reacting an imine nitrogen with hydrogen fluoride. Crystallization of the compound was achieved by using the standard crystallization process for trifluoroacetic acid (TFA) salts. The molecular structure of 1,3-diiodotetrafluorobenzene shows a hydrogen bond between the imine nitrogen and hydrogen fluoride. This compound is activated through treatment with trifluoroacetic acid (TFA) and then reacted with chloride ion in trifluoromethanesulfonic acid (TFMSA). The resulting chloride salt can be isolated as a white solid.</p>Formula:C6F4I2Purity:Min. 95%Molecular weight:401.87 g/mol


