CAS 67818-41-1
:1-(2-chloro-4-nitrophenyl)ethanone
Description:
1-(2-Chloro-4-nitrophenyl)ethanone, with the CAS number 67818-41-1, is an organic compound characterized by its functional groups and structural features. It contains a ketone group (ethanone) and a substituted aromatic ring, specifically a chloronitrophenyl moiety. The presence of the chloro and nitro substituents on the aromatic ring significantly influences its chemical reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. Its reactivity can be attributed to the electron-withdrawing effects of the nitro and chloro groups, which can enhance electrophilic substitution reactions. Additionally, the compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards.
Formula:C8H6ClNO3
InChI:InChI=1/C8H6ClNO3/c1-5(11)7-3-2-6(10(12)13)4-8(7)9/h2-4H,1H3
SMILES:CC(=O)c1ccc(cc1Cl)N(=O)=O
Synonyms:- 1-(2-Chloro-4-Nitrophenyl)Ethan-1-One
- 2-Chloro-4-nitroacetophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2'-Chloro-4'-nitroacetophenone
CAS:Formula:C8H6ClNO3Purity:>98.0%(GC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:199.591-(2-Chloro-4-nitrophenyl)ethanone
CAS:Formula:C8H6ClNO3Purity:98%Color and Shape:SolidMolecular weight:199.59111-(2-Chloro-4-nitrophenyl)ethanone
CAS:1-(2-Chloro-4-nitrophenyl)ethanonePurity:98%Molecular weight:199.59g/mol2'-Chloro-4'-nitroacetophenone
CAS:<p>2'-Chloro-4'-nitroacetophenone is a reagent that is used in the synthesis of tulobuterol, an oxirane that binds to β2-adrenergic receptors. 2'-Chloro-4'-nitroacetophenone is also used for the synthesis of other drugs, such as benzylated alcohols and phenols. This product has been shown to be metabolized into a number of metabolites, including hydroxybenzyl alcohol and hydroxybenzyl glucuronide.</p>Formula:C8H6ClNO3Purity:Min. 95%Color and Shape:Dark yellow solid.Molecular weight:199.59 g/mol




