CAS 678185-92-7
:3-[[[(4-Chlorophenyl)amino]carbonyl]amino]-4-ethoxybenzenesulfonyl chloride
Description:
3-[[[(4-Chlorophenyl)amino]carbonyl]amino]-4-ethoxybenzenesulfonyl chloride, with CAS number 678185-92-7, is a synthetic organic compound characterized by its complex structure that includes a sulfonyl chloride functional group. This compound features a sulfonamide moiety, which is known for its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the 4-chlorophenyl group contributes to its lipophilicity, potentially enhancing its biological activity. The ethoxy group adds to its solubility profile, making it suitable for various chemical reactions. As a sulfonyl chloride, it is likely to be reactive towards nucleophiles, making it useful in coupling reactions or as an intermediate in the synthesis of more complex molecules. The compound's characteristics, including its molecular weight, melting point, and solubility, would be important for practical applications, particularly in drug formulation and development. Safety precautions should be observed when handling this compound due to the presence of reactive functional groups.
Formula:C15H14Cl2N2O4S
InChI:InChI=1S/C15H14Cl2N2O4S/c1-2-23-14-8-7-12(24(17,21)22)9-13(14)19-15(20)18-11-5-3-10(16)4-6-11/h3-9H,2H2,1H3,(H2,18,19,20)
InChI key:InChIKey=WVVZHHIJLVZEIV-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=C(Cl)C=C1)=O)C2=C(OCC)C=CC(S(Cl)(=O)=O)=C2
Synonyms:- Benzenesulfonyl chloride, 3-[[[(4-chlorophenyl)amino]carbonyl]amino]-4-ethoxy-
- 3-[[[(4-Chlorophenyl)amino]carbonyl]amino]-4-ethoxybenzenesulfonyl chloride
- 3-[3-(4-CHLORO-PHENYL)-UREIDO]-4-ETHOXY-BENZENE SULFONYL CHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-[3-(4-Chlorophenyl)ureido]-4-ethoxybenzenesulfonyl chloride
CAS:Formula:C15H14Cl2N2O4SColor and Shape:SolidMolecular weight:389.25
