CAS 67831-42-9
:(3R,4S,5S,6R)-4,5,6-tribenzyloxy-2-(benzyloxymethyl)tetrahydropyran-3-ol
Description:
The chemical substance known as "(3R,4S,5S,6R)-4,5,6-tribenzyloxy-2-(benzyloxymethyl)tetrahydropyran-3-ol," with the CAS number 67831-42-9, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple benzyloxy substituents, indicating the presence of benzyl groups attached to the oxygen atoms, which can enhance its solubility and reactivity. The stereochemistry of the molecule is defined by the specific configuration at the chiral centers, denoted by the (3R,4S,5S,6R) notation, which influences its biological activity and interactions. Such compounds are often of interest in medicinal chemistry and organic synthesis due to their potential applications in drug development and as intermediates in the synthesis of more complex molecules. The presence of hydroxyl (-OH) groups contributes to its polarity and ability to form hydrogen bonds, which can affect its physical properties, such as melting point and solubility in various solvents.
Formula:C34H36O6
InChI:InChI=1/C34H36O6/c35-31-30(25-36-21-26-13-5-1-6-14-26)40-34(39-24-29-19-11-4-12-20-29)33(38-23-28-17-9-3-10-18-28)32(31)37-22-27-15-7-2-8-16-27/h1-20,30-35H,21-25H2/t30?,31-,32+,33+,34-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,2,3,6-Tetra-O-benzyl-β-D-glucopyranoside
CAS:1,2,3,6-Tetra-O-benzyl-β-D-glucopyranoside is a synthetic compound that is produced by the modification of natural sugars. It was first synthesized by a team of chemists led by Professor Robert Burns Woodward. This molecule has been modified with methyl groups and fluorine atoms to improve its stability and to provide a more convenient method for its analysis. 1,2,3,6-Tetra-O-benzyl-β-D-glucopyranoside can be used in the synthesis of oligosaccharides and polysaccharides.Formula:C34H36O6Purity:Min. 95%Color and Shape:PowderMolecular weight:540.65 g/molBenzyl 2,3,6-Tri-O-benzyl-beta-D-glucopyranoside
CAS:Controlled ProductFormula:C34H36O6Color and Shape:NeatMolecular weight:540.65


