CAS 67832-70-6

2-(phenylamino)butanoic acid

Description:

2-(Phenylamino)butanoic acid, also known as phenylalanine, is an α-amino acid that plays a crucial role in the biosynthesis of proteins. It features a butanoic acid backbone with a phenylamino group attached to the second carbon. This compound is characterized by its polar nature due to the carboxylic acid functional group, which can participate in hydrogen bonding, enhancing its solubility in water. The presence of the phenyl group contributes to its hydrophobic characteristics, influencing its interactions in biological systems. As an essential amino acid, it cannot be synthesized by the human body and must be obtained through dietary sources. It is involved in various metabolic pathways, including the synthesis of neurotransmitters like dopamine, norepinephrine, and epinephrine. Additionally, 2-(phenylamino)butanoic acid is important in the production of melanin and other biomolecules. Its structural properties and reactivity make it a subject of interest in both biochemical research and pharmaceutical applications.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1/C10H13NO2/c1-2-9(10(12)13)11-8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3,(H,12,13)

SMILES: CCC(C(=O)O)Nc1ccccc1

2-anilinobutanoic acid

CAS: 67832-70-6

Formula: C₁₀H₁₃NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.2157

Ref: IN-DA00FD83

2-(Phenylamino)butanoic acid

CAS: 67832-70-6

2-(Phenylamino)butanoic acid

Purity: 97%

Molecular weight: 179.22g/mol

Ref: 54-OR1055283

2-anilinobutanoic acid

Controlled Product

CAS: 67832-70-6

Applications 2-anilinobutanoic acid (cas# 67832-70-6) is a useful research chemical.

Formula: C₁₀H₁₃NO₂

Color and Shape: Neat

Molecular weight: 179.22

Ref: TR-B411833

2-(Phenylamino)butanoic acid

CAS: 67832-70-6

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₂

Purity: Min. 95%

Molecular weight: 179.22 g/mol

Ref: 3D-SCA83270