CymitQuimica logo

CAS 6784-38-9

:

3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium

Description:
3-Ethyl-12H-indolo[2,3-a]quinolizin-5-ium, with the CAS number 6784-38-9, is a heterocyclic compound that belongs to the class of indole derivatives. This substance features a fused ring system that combines indole and quinolizine structures, contributing to its unique chemical properties. It typically exhibits a planar structure, which is characteristic of many aromatic compounds, allowing for potential π-π stacking interactions. The presence of the ethyl group enhances its solubility and may influence its reactivity and biological activity. As a quaternary ammonium compound, it carries a positive charge, which can affect its interaction with biological systems and its ability to cross cell membranes. This compound may exhibit interesting photophysical properties, making it a candidate for applications in organic electronics or as a fluorescent probe. Additionally, its structural features suggest potential uses in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C17H15N2
InChI:InChI=1/C17H14N2/c1-2-12-7-8-16-17-14(9-10-19(16)11-12)13-5-3-4-6-15(13)18-17/h3-11H,2H2,1H3/p+1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.