CAS 67862-03-7

(2S)-2-(tert-butoxycarbonylamino)decanoic acid

Description:

(2S)-2-(tert-butoxycarbonylamino)decanoic acid, with CAS number 67862-03-7, is an amino acid derivative characterized by its structure, which includes a decanoic acid backbone and a tert-butoxycarbonyl (Boc) protecting group on the amino functional group. This compound is typically used in peptide synthesis and as an intermediate in organic synthesis due to its ability to protect the amino group during reactions. The presence of the Boc group enhances the stability of the amino acid under various reaction conditions, making it a valuable building block in the synthesis of more complex molecules. The decanoic acid portion contributes to the hydrophobic nature of the compound, influencing its solubility and interaction with biological systems. Additionally, the stereochemistry indicated by (2S) suggests that the compound has a specific spatial arrangement, which is crucial for its biological activity and reactivity. Overall, this compound is significant in the fields of medicinal chemistry and biochemistry, particularly in the development of pharmaceuticals and peptide-based therapeutics.

Formula: C₁₅H₂₉NO₄

InChI: InChI=1/C15H29NO4/c1-5-6-7-8-9-10-11-12(13(17)18)16-14(19)20-15(2,3)4/h12H,5-11H2,1-4H3,(H,16,19)(H,17,18)/t12-/m0/s1

SMILES: CCCCCCCC[C@@H](C(=O)O)N=C(O)OC(C)(C)C

N-Boc-2-octyl-l-glycine

CAS: 67862-03-7

Formula: C₁₅H₂₉NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 287.3951

Ref: IN-DA005P85

N-Boc-2-Octyl-L-glycine

CAS: 67862-03-7

N-Boc-2-Octyl-L-glycine

Purity: 95%

Molecular weight: 287.40g/mol

Ref: 54-OR93273

N-Boc-2-Octyl-L-glycine

CAS: 67862-03-7

Formula: C₁₅H₂₉NO₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 287.4

Ref: 10-F048662