CAS 67866-76-6
:3-fluoroaspartic acid
Description:
3-Fluoroaspartic acid is an amino acid derivative characterized by the presence of a fluorine atom at the third carbon position of the aspartic acid backbone. Its molecular formula is C4H6FNO4, and it features both carboxylic acid and amino functional groups, which are typical of amino acids. The fluorine substitution can influence the compound's biochemical properties, potentially affecting its interaction with enzymes and receptors. 3-Fluoroaspartic acid is often studied for its role as a biochemical probe and its potential applications in drug design, particularly in the context of neuropharmacology, due to its structural similarity to aspartate, a key neurotransmitter. The compound is typically synthesized through specific chemical reactions involving aspartic acid and fluorinating agents. As with many fluorinated compounds, it may exhibit unique solubility and reactivity characteristics compared to its non-fluorinated counterparts. Safety and handling precautions are essential when working with this substance, as with all chemical compounds, to mitigate any potential hazards associated with its use.
Formula:C4H6FNO4
InChI:InChI=1/C4H6FNO4/c5-1(3(7)8)2(6)4(9)10/h1-2H,6H2,(H,7,8)(H,9,10)
SMILES:C(C(C(=O)O)N)(C(=O)O)F
Synonyms:- 3-Ammonio-3-Carboxy-2-Fluoropropanoate
- Aspartic Acid, 3-Fluoro-
- beta-Fluoroaspartic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ref: 4Z-A-147010
Discontinued product

