CAS 67869-88-9

1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazine

Description:

1-(2,3-Dihydro-1,4-benzodioxin-6-ylmethyl)piperazine, with the CAS number 67869-88-9, is a chemical compound characterized by its unique structure that includes a piperazine ring and a benzodioxin moiety. This compound typically exhibits properties associated with both piperazine derivatives and benzodioxins, which may include moderate solubility in polar solvents and potential bioactivity. The presence of the benzodioxin structure suggests possible interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Its molecular structure may confer specific pharmacological properties, potentially influencing its activity as a ligand for various receptors or enzymes. Additionally, the compound may undergo typical chemical reactions associated with piperazines, such as alkylation or acylation, and may also participate in hydrogen bonding due to the presence of nitrogen atoms in the piperazine ring. Overall, this compound's characteristics make it a subject of interest for further research in drug development and chemical synthesis.

Formula: C₁₃H₁₈N₂O₂

InChI: InChI=1/C13H18N2O2/c1-2-12-13(17-8-7-16-12)9-11(1)10-15-5-3-14-4-6-15/h1-2,9,14H,3-8,10H2

SMILES: c1cc2c(cc1CN1CCNCC1)OCCO2

1-[(2,3-Dihydro-1,4-benzodioxin-6-yl)methyl]piperazine

Controlled Product

CAS: 67869-88-9

Versatile small molecule scaffold

Formula: C₁₃H₁₈N₂O₂

Purity: Min. 95%

Molecular weight: 234.29 g/mol

Ref: 3D-SCA86988