CAS 67869-90-3
:3,4-dihydro-2H-1,5-benzodioxepine-7-carbaldehyde
Description:
3,4-Dihydro-2H-1,5-benzodioxepine-7-carbaldehyde, with the CAS number 67869-90-3, is a chemical compound characterized by its unique bicyclic structure that incorporates a dioxepine ring fused to a benzene ring. This compound features an aldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the dioxepine moiety suggests that it may exhibit interesting chemical properties, including the ability to participate in various reactions such as nucleophilic additions or cycloadditions. Additionally, the compound may possess biological activity, making it of interest in medicinal chemistry. Its structural features may influence its solubility, stability, and interaction with biological targets. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral data would be essential for practical applications and further research. Overall, 3,4-dihydro-2H-1,5-benzodioxepine-7-carbaldehyde represents a versatile scaffold for further exploration in synthetic and medicinal chemistry.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c11-7-8-2-3-9-10(6-8)13-5-1-4-12-9/h2-3,6-7H,1,4-5H2
SMILES:C1COc2ccc(cc2OC1)C=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Dihydro-2H-1,5-benzodioxepin-7-carboxaldehyde, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H10O3Purity:95%Color and Shape:Fused solid or clear liquid as melt, Pale yellow to brownMolecular weight:178.192H-1,5-Benzodioxepin-7-carboxaldehyde,3,4-dihydro-
CAS:Formula:C10H10O3Purity:95%Color and Shape:LiquidMolecular weight:178.18463,4-Dihydro-2H-1,5-benzodioxepine-7-carboxaldehyde
CAS:3,4-Dihydro-2H-1,5-benzodioxepine-7-carboxaldehydeFormula:C10H10O3Purity:95%Color and Shape: orange liquidMolecular weight:178.18g/mol3,4-dihydro-2H-1,5-benzodioxepine-7-carbaldehyde
CAS:Formula:C10H10O3Purity:98%Color and Shape:LiquidMolecular weight:178.187



