CAS 67873-21-6

2-amino-6-(1-methylhydrazinyl)pyrimidin-4(1H)-one

Description:

2-amino-6-(1-methylhydrazinyl)pyrimidin-4(1H)-one, with the CAS number 67873-21-6, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with an amino group and a 1-methylhydrazinyl group, which contributes to its potential biological activity. The presence of the amino group indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The hydrazinyl moiety may impart reactivity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure suggests potential applications in areas such as cancer research or as a building block in the synthesis of more complex molecules. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many nitrogen-containing heterocycles, it may exhibit interesting electronic properties, making it a subject of study in various chemical and biological contexts.

Formula: C₅H₉N₅O

InChI: InChI=1/C5H9N5O/c1-10(7)3-2-4(11)9-5(6)8-3/h2H,7H2,1H3,(H3,6,8,9,11)

SMILES: CN(c1cc(nc(=N)[nH]1)O)N

6-(1-Methylhydrazinyl)-2-aminopyrimidin-4(1H)-one

CAS: 67873-21-6

6-(1-Methylhydrazinyl)-2-aminopyrimidin-4(1H)-one

Purity: ≥95%

Molecular weight: 155.16g/mol

Ref: 54-OR322792