CymitQuimica logo

CAS 67875-58-5

:

L-tyrosyl-D-alanyl-N-{(2S)-4-(methylsulfanyl)-2-[(2,3,4,5,6-pentafluoro-L-phenylalanyl)amino]butanoyl}glycinamide

Description:
L-tyrosyl-D-alanyl-N-{(2S)-4-(methylsulfanyl)-2-[(2,3,4,5,6-pentafluoro-L-phenylalanyl)amino]butanoyl}glycinamide, with the CAS number 67875-58-5, is a synthetic peptide that exhibits unique structural characteristics due to its complex amino acid composition. This compound features a combination of L-tyrosine and D-alanine, which contributes to its chirality and potential biological activity. The presence of a methylsulfanyl group enhances its stability and may influence its interaction with biological targets. Additionally, the incorporation of a pentafluorinated phenylalanine residue suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals with enhanced potency or selectivity. The peptide's structure may also confer specific solubility and permeability properties, making it a candidate for further research in drug design and delivery systems. Overall, this compound exemplifies the intricate relationship between peptide structure and function, highlighting the importance of amino acid modifications in tailoring biological activity.
Formula:C28H33F5N6O6S
InChI:InChI=1/C28H33F5N6O6S/c1-12(37-26(43)16(34)9-13-3-5-14(40)6-4-13)25(42)36-11-19(41)39-28(45)18(7-8-46-2)38-27(44)17(35)10-15-20(29)22(31)24(33)23(32)21(15)30/h3-6,12,16-18,40H,7-11,34-35H2,1-2H3,(H,36,42)(H,37,43)(H,38,44)(H,39,41,45)/t12-,16+,17+,18+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.