CAS 67884-03-1
:Platycodin D3
Description:
Platycodin D3 is a triterpenoid saponin derived from the root of the Platycodon grandiflorus, commonly known as balloon flower. This compound is characterized by its complex structure, which includes a steroid-like backbone and multiple sugar moieties, contributing to its biological activity. Platycodin D3 exhibits various pharmacological properties, including anti-inflammatory, immunomodulatory, and anticancer effects, making it a subject of interest in medicinal chemistry and pharmacology. Its mechanism of action often involves the modulation of signaling pathways and the enhancement of immune responses. Additionally, Platycodin D3 is known for its potential to improve respiratory health and has been traditionally used in herbal medicine for treating respiratory ailments. The compound is typically studied in the context of natural product chemistry and has garnered attention for its therapeutic potential, although further research is necessary to fully elucidate its mechanisms and efficacy in clinical settings. As with many natural compounds, the extraction and purification processes can influence its bioactivity and stability.
Formula:C63H102O33
InChI:InChI=1S/C63H102O33/c1-24-45(92-51-44(81)46(29(70)18-85-51)93-55-48(82)62(84,22-67)23-88-55)40(77)43(80)52(89-24)94-47-35(72)28(69)17-86-54(47)96-56(83)63-12-11-57(2,3)13-26(63)25-7-8-32-58(4)14-27(68)49(61(20-65,21-66)33(58)9-10-59(32,5)60(25,6)15-34(63)71)95-53-42(79)39(76)37(74)31(91-53)19-87-50-41(78)38(75)36(73)30(16-64)90-50/h7,24,26-55,64-82,84H,8-23H2,1-6H3
InChI key:InChIKey=XHKCYIRZWRRXNG-UHFFFAOYSA-N
SMILES:C(OC1C(OC2C(O)C(O)C(OC3C(O)C(OC4C(O)C(CO)(O)CO4)C(O)CO3)C(C)O2)C(O)C(O)CO1)(=O)C56C(C=7C(C)(CC5O)C8(C)C(CC7)C9(C)C(CC8)C(CO)(CO)C(OC%10OC(COC%11OC(CO)C(O)C(O)C%11O)C(O)C(O)C%10O)C(O)C9)CC(C)(C)CC6
Synonyms:- Olean-12-en-28-oic acid, 3-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-2,16,23,24-tetrahydroxy-, O-D-apio-β-D-furanosyl-(1→3)-O-β-D-xylopyranosyl-(1→4)-O-6-deoxy-α-L-mannopyranosyl-(1→2)-α-L-arabinopyranosyl ester, (2β,3β,16α)-
- Platycodin D3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Platycodin D3
CAS:Platycodin D3 is a NF-κB inhibitor, it could as expectorants in diverse inflammatory pulmonary diseases, it can regulate the production and secretion of airway
Formula:C63H102O33Purity:98.91% - 99.84%Color and Shape:SolidMolecular weight:1387.46Platycodin D3
CAS:Platycodin D3 is a bioactive compound, which is a triterpenoid saponin derived from the root of Platycodon grandiflorum, commonly known as balloon flower. As a secondary metabolite produced by this herbaceous plant, Platycodin D3 is isolated through complex phytochemical extraction and purification processes. Its mode of action is primarily centered around modulating inflammatory pathways and exhibiting antitumor activities. It targets various cell signaling pathways and molecular mechanisms, such as inhibiting NF-κB activation and inducing apoptosis in cancer cells.
Formula:C63H102O33Purity:Min. 95%Molecular weight:1,387.48 g/mol




