CAS 67884-10-0

Glucocamelinin

Description:

Glucocamelinin, with the CAS number 67884-10-0, is a chemical compound that is primarily derived from the hydrolysis of camel milk proteins. It is characterized by its unique structure, which includes a combination of amino acids and carbohydrates, contributing to its potential bioactive properties. This substance is known for its antioxidant and antimicrobial activities, making it of interest in food science and nutrition. Glucocamelinin may also exhibit immunomodulatory effects, which could be beneficial in various health applications. Its solubility in water and stability under various pH conditions enhance its usability in formulations. Additionally, research into glucocamelinin is ongoing, focusing on its potential therapeutic benefits and applications in functional foods. As with many bioactive compounds, the specific effects and mechanisms of action are still being explored, highlighting the importance of further studies to fully understand its properties and potential uses in health and nutrition.

Formula: C₁₈H₃₅NO₁₀S₃

InChI: InChI=1S/C18H35NO10S3/c1-31(24)11-9-7-5-3-2-4-6-8-10-14(19-29-32(25,26)27)30-18-17(23)16(22)15(21)13(12-20)28-18/h13,15-18,20-23H,2-12H2,1H3,(H,25,26,27)/t13-,15-,16+,17-,18+,31?/m1/s1

InChI key: InChIKey=PPIATLIUZMGEJB-IZVKOHMMSA-N

SMILES: S(C(CCCCCCCCCCS(C)=O)=NOS(=O)(=O)O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O

Synonyms:

• Glucocamelinin
• β-D-Glucopyranose, 1-thio-, 1-[11-(methylsulfinyl)-N-(sulfooxy)undecanimidate]

Glucocamelinin potassium salt

CAS: 67884-10-0

Glucocamelinin potassium salt analytical standard provided with w/w absolute assay, to be used for quantitative titration.

Formula: C₁₈H₃₄NO₁₀S₃K

Purity: (HPLC) ≥98%

Color and Shape: Powder

Molecular weight: 559.75

Ref: 11-2517S

Glucocamelinin potassium salt

CAS: 67884-10-0

Natural glycoside

Formula: C₁₈H₃₄NO₁₀S₃K

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 559.76

Ref: 5G-85744

Glucocamelinin potassium salt

CAS: 67884-10-0

Glucocamelinin potassium salt is a glucosinolate derivative, which is a naturally occurring compound derived from certain plants, particularly from the family Brassicaceae, such as camelina. It is characterized by its sulfur-containing compounds, which play a significant role in plant defense. Glucocamelinin potassium salt functions primarily through enzymatic hydrolysis that releases biologically active compounds, known as isothiocyanates, upon tissue damage or degradation by specific plant enzymes like myrosinase.

Formula: C₁₈H₃₄KNO₁₀S₃

Purity: Min. 95%

Molecular weight: 559.76 g/mol

Ref: 3D-SCA88410