CAS 67886-70-8
:6-methoxy-2-naphthonitrile
Description:
6-Methoxy-2-naphthonitrile is an organic compound characterized by its naphthalene backbone substituted with a methoxy group and a nitrile functional group. The methoxy group (-OCH3) is located at the 6-position of the naphthalene ring, while the nitrile group (-CN) is positioned at the 2-position. This compound typically appears as a solid at room temperature and is known for its aromatic properties, which contribute to its stability and potential reactivity. The presence of the nitrile group imparts polar characteristics, making it soluble in polar solvents. Additionally, 6-methoxy-2-naphthonitrile may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and material science. Its synthesis often involves the functionalization of naphthalene derivatives, and it can be utilized in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C12H9NO
InChI:InChI=1/C12H9NO/c1-14-12-5-4-10-6-9(8-13)2-3-11(10)7-12/h2-7H,1H3
SMILES:COc1ccc2cc(ccc2c1)C#N
Synonyms:- 2-Cyano-6-methoxynaphthalene
- 6-Methoxynaphthalene-2-Carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Methoxy-2-naphthonitrile
CAS:<p>6-Methoxy-2-naphthonitrile is a phenolic compound that has been synthesized by reacting cyclobutane with nitroethane. It has antihypertensive activity. Phenols are aromatic compounds that can be found in many plants, animals, and microorganisms. They have an oxygen atom attached to a hydroxyl group (-OH) and are classified as either simple or polycyclic. 6-Methoxy-2-naphthonitrile is a simple phenol that contains one ring of six carbon atoms. The molecule can also be classified as an aldehyde because it contains the -CHO functional group on the carbon adjacent to the hydroxyl (-OH). The nmr spectra of 6-methoxy-2-naphthonitrile indicate that it is chiral, which means it can exist in two forms that are non superimposable mirror images of each other. This property makes the</p>Formula:CH3OC10H6CNPurity:Min. 95%Molecular weight:183.21 g/mol



