CAS 67910-07-0

Homobaldrinal

Description:

Homobaldrinal is a chemical compound that belongs to the class of terpenoids, specifically a type of sesquiterpene. It is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its unique properties. Homobaldrinal is typically found in certain plant species and is known for its potential applications in the fragrance and flavor industries due to its aromatic qualities. Additionally, it may exhibit biological activities, although specific pharmacological effects can vary. The compound is often studied for its potential use in natural products and may have implications in fields such as perfumery, cosmetics, and possibly even medicinal chemistry. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as temperature and pH. Overall, homobaldrinal represents a fascinating area of study within organic chemistry and natural product research.

Formula: C₁₅H₁₆O₄

InChI: InChI=1S/C15H16O4/c1-10(2)5-15(17)19-8-12-7-18-9-14-11(6-16)3-4-13(12)14/h3-4,6-7,9-10H,5,8H2,1-2H3

InChI key: InChIKey=LTVSLKWNAZKBEX-UHFFFAOYSA-N

SMILES: C(OC(CC(C)C)=O)C=1C=2C(C(C=O)=CC2)=COC1

Synonyms:

• Butanoic acid, 3-methyl-, (7-formylcyclopenta[c]pyran-4-yl)methyl ester
• Homobaldrinal
• (7-Formylcyclopenta[c]pyran-4-yl)methyl 3-methylbutanoate
• 3-Methyl-butanoic acid (7-formylcyclopenta[c]pyran-4-yl)methyl ester

Homobaldrinal

CAS: 67910-07-0

Homobaldrinal has low toxic activity. It has genotoxic activity in the Salmonella/microsome test and the SOS-chromotest.

Formula: C₁₅H₁₆O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 260.29

Ref: TM-TN4219

Homobaldrinal

CAS: 67910-07-0

Homobaldrinal is a synthetic alkaloid, which is derived from the structural modification of natural plant alkaloids. Its mechanism of action involves interaction with neurotransmitter receptors in the central nervous system. Homobaldrinal is thought to modulate synaptic transmission, potentially altering neuronal excitability by influencing ion channel activity or receptor binding properties.

Formula: C₁₅H₁₆O₄

Purity: Min. 95%

Molecular weight: 260.10486

Ref: 3D-XH178327