CAS 67915-02-0
:1-[4-(3-Hydroxyphenyl)-1-piperazinyl]ethanone
Description:
1-[4-(3-Hydroxyphenyl)-1-piperazinyl]ethanone, with the CAS number 67915-02-0, is a chemical compound that features a piperazine ring, which is a common structural motif in many pharmaceuticals. This compound is characterized by the presence of a hydroxyphenyl group, which contributes to its potential biological activity. The ethanone moiety indicates that it contains a ketone functional group, which can participate in various chemical reactions. The presence of the piperazine ring suggests that it may exhibit properties such as psychoactivity or interaction with neurotransmitter systems, making it of interest in medicinal chemistry. Additionally, the hydroxy group can enhance solubility and reactivity, influencing the compound's pharmacokinetics and pharmacodynamics. Overall, this compound's unique structure may lead to diverse applications in drug development, particularly in the fields of psychiatry and neurology, although specific biological activities would require further investigation through experimental studies.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-10(15)13-5-7-14(8-6-13)11-3-2-4-12(16)9-11/h2-4,9,16H,5-8H2,1H3
InChI key:InChIKey=IQFHOABEFGNIQX-UHFFFAOYSA-N
SMILES:OC=1C=C(N2CCN(C(C)=O)CC2)C=CC1
Synonyms:- 1-[4-(3-Hydroxyphenyl)-1-piperazinyl]ethanone
- 3-[4-(Acetyl)piperazin-1-yl]phenol
- Piperazine, 1-acetyl-4-(3-hydroxyphenyl)-
- Piperazine, 1-acetyl-4-(3-hydroxyphenyl)- (9CI)
- Ethanone, 1-[4-(3-hydroxyphenyl)-1-piperazinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-[4-(Acetyl)piperazin-1-yl]phenol
CAS:Controlled ProductApplications 3-[4-(Acetyl)piperazin-1-yl]phenol is used in the preparation of fungicidal and bactericidal 1-(1,3-dioxolan-2-ylmethyl)-1H-imidazoles and -1H-1,2,4-triazoles and their salts.
References Heeres, J., et al.: Ger. Offen. (1978), DE 2804096 A1 19780803Formula:C12H16N2O2Color and Shape:NeatMolecular weight:220.268
