CAS 6792-07-0
:(4alpha,15alpha,16S,19E)-4-methylsarpagan-4-ium-17-ol
Description:
The chemical substance known as (4alpha,15alpha,16S,19E)-4-methylsarpagan-4-ium-17-ol, with the CAS number 6792-07-0, is a member of the alkaloid family, specifically derived from the sarpagine class of compounds. It features a complex bicyclic structure characterized by a nitrogen atom in a piperidine-like ring, contributing to its basicity and potential biological activity. The presence of multiple stereocenters indicates that it can exist in various stereoisomeric forms, which may influence its pharmacological properties. This compound is notable for its hydroxyl (-OH) group, which enhances its solubility in polar solvents and may play a role in its interaction with biological targets. Alkaloids like this one are often studied for their potential therapeutic effects, including analgesic and anti-inflammatory properties. However, detailed studies on its specific biological activities, mechanisms of action, and potential applications in medicine or pharmacology would be necessary to fully understand its significance.
Formula:C20H25N2O
InChI:InChI=1/C20H25N2O/c1-3-12-10-22(2)18-9-15-13-6-4-5-7-17(13)21-20(15)19(22)8-14(12)16(18)11-23/h3-7,14,16,18-19,21,23H,8-11H2,1-2H3/q+1/b12-3-/t14-,16+,18?,19+,22-/m1/s1
SMILES:CC=C1CN2(C)C3Cc4c5ccccc5[nH]c4C2CC1C3CO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Macusine B
CAS:<p>Macusine B is a dual inhibitor, has almost equal inhibitory activity on both acetylcholinesterase (AChE) and butyrylcholinesterase (BChE).</p>Formula:C20H25N2OPurity:98%Color and Shape:SolidMolecular weight:309.432Macusine B
CAS:<p>Macusine B is a bioactive alkaloid, which is a naturally occurring chemical compound derived from specific plant species known for their medicinal properties. This compound acts as an inhibitor of certain biochemical pathways involved in cancer cell proliferation, primarily targeting cell cycle regulation and apoptosis induction. It interferes with DNA replication and repair mechanisms, thereby promoting programmed cell death in malignant cells.</p>Formula:C20H25N2OPurity:Min. 95%Molecular weight:309.4 g/mol




