CymitQuimica logo

CAS 679406-03-2

:

4,6-Dichloro-pyridazine-3-carboxylic acid ethyl ester

Description:
4,6-Dichloro-pyridazine-3-carboxylic acid ethyl ester is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of two chlorine substituents at the 4 and 6 positions of the pyridazine ring contributes to its reactivity and potential applications in various chemical reactions. The carboxylic acid ethyl ester functional group enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 4,6-Dichloro-pyridazine-3-carboxylic acid ethyl ester is a versatile compound with significant implications in chemical research and development.
Formula:C7H6Cl2N2O2
InChI:InChI=1S/C7H6Cl2N2O2/c1-2-13-7(12)6-4(8)3-5(9)10-11-6/h3H,2H2,1H3
InChI key:MOWPWJUYSRHMHS-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NN=C(C=C1Cl)Cl
Synonyms:
  • Ethyl 4,6-dichloropyrridazine-3-carboxylate
Found 6 products.