CAS 67945-53-3
:[(3R,4S,5S,6R)-3,4,5-triacetoxy-6-(4-methyl-2-oxo-chromen-7-yl)oxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3R,4S,5S,6R)-3,4,5-triacetoxy-6-(4-methyl-2-oxo-chromen-7-yl)oxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 67945-53-3 is a complex organic compound characterized by its intricate molecular structure, which includes a tetrahydropyran ring and multiple acetoxy groups. This compound features chirality, indicated by its specific stereochemical configuration at several carbon centers, which can influence its biological activity and reactivity. The presence of the chromen-7-yl moiety suggests potential applications in medicinal chemistry, particularly in the development of bioactive compounds, as chromenes are known for their diverse pharmacological properties. The acetoxy groups enhance solubility and reactivity, making the compound potentially useful in various chemical reactions or as a precursor in synthetic pathways. Overall, this substance exemplifies the complexity and diversity of organic compounds, particularly those with potential therapeutic applications.
Formula:C24H26O12
InChI:InChI=1/C24H26O12/c1-11-8-20(29)35-18-9-16(6-7-17(11)18)34-24-23(33-15(5)28)22(32-14(4)27)21(31-13(3)26)19(36-24)10-30-12(2)25/h6-9,19,21-24H,10H2,1-5H3/t19?,21-,22+,23+,24+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Methylumbelliferyl 2,3,4,6-tetra-O-acetyl-a-D-glucopyranoside
CAS:4-Methylumbelliferyl 2,3,4,6-tetra-O-acetyl-a-D-glucopyranoside is a fluorescent marker for nucleic acid molecules. It can be applied to identify the metabolic pathways of bacteria in an ecosystem by using fluorescence microscopy. 4-Methylumbelliferyl 2,3,4,6-tetra-O-acetyl-a-D-glucopyranoside is also used to measure the activity of some enzymes in vitro. This compound has been shown to be effective against spittlebugs and other pests that feed on plant sap. The toxic effect of this compound is due to its ability to inhibit acetate synthesis and disrupt membrane transport systems.Purity:Min. 95%Molecular weight:506.46 g/molRef: 3D-EM04826
Discontinued product

