CAS 67967-11-7
:1,7-naphthyridin-8(7H)-one
Description:
1,7-Naphthyridin-8(7H)-one, identified by its CAS number 67967-11-7, is a heterocyclic organic compound characterized by a fused bicyclic structure that includes a pyridine ring and a naphthalene moiety. This compound features a keto group at the 8-position, contributing to its reactivity and potential biological activity. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents due to the presence of the nitrogen atom in the ring structure, which can engage in hydrogen bonding. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural features allow for potential interactions with biological targets, and it may serve as a scaffold for the synthesis of more complex derivatives. Additionally, 1,7-naphthyridin-8(7H)-one can be synthesized through various chemical reactions, including cyclization processes involving appropriate precursors. As with many heterocycles, its properties can be influenced by substituents on the ring, affecting its reactivity and biological activity.
Formula:C8H6N2O
InChI:InChI=1/C8H6N2O/c11-8-7-6(3-5-10-8)2-1-4-9-7/h1-5H,(H,10,11)
SMILES:c1cc2ccnc(c2nc1)O
Synonyms:- 1,7-Naphthyridin-8-ol
- 1,7-Naphthyridin-8(7H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7H-1,7-NAPHTHYRIDIN-8-ONE
CAS:Formula:C8H6N2OPurity:98%Color and Shape:SolidMolecular weight:146.14601,7-Naphthyridin-8(7H)-one
CAS:<p>1,7-Naphthyridin-8(7H)-one is a polycyclic compound that has been used as an intermediate in the synthesis of a variety of other compounds. It is also used as an iterative reagent for the annulation reactions of cyclic olefins. It can be prepared by oxidative annulation between picolinamide and 1,2,3,4-tetrahydroquinoline. The regioselectivity of this reaction can be controlled by using rhodium or copper catalysts.</p>Formula:C8H6N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:146.15 g/mol



