CAS 67967-12-8

4-Bromo-1,7-naphthyridin-2(1H)-one

Description:

4-Bromo-1,7-naphthyridin-2(1H)-one is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of a bromine atom at the 4-position and a carbonyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic naphthyridine framework. It is often utilized in medicinal chemistry and research for its potential biological activities, including antimicrobial and anticancer properties. The compound's reactivity can be influenced by the electron-withdrawing effects of the bromine and carbonyl groups, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, its structural features allow for various functionalizations, which can enhance its pharmacological profile. As with many heterocycles, it may also participate in hydrogen bonding and π-π stacking interactions, influencing its behavior in biological systems.

Formula: C₈H₅BrN₂O

InChI: InChI=1S/C8H5BrN2O/c9-6-3-8(12)11-7-4-10-2-1-5(6)7/h1-4H,(H,11,12)

InChI key: InChIKey=HXNAZEIWAPMMDE-UHFFFAOYSA-N

SMILES: BrC=1C=2C(NC(=O)C1)=CN=CC2

Synonyms:

• 4-Bromo-2-hydroxy-1,7-naphthyridine
• 4-Bromo-1,7-naphthyridin-2(1H)-one
• 1,7-Naphthyridin-2(1H)-one, 4-bromo-

4-Bromo-1,2-dihydro-1,7-naphthyridin-2-one

CAS: 67967-12-8

Versatile small molecule scaffold

Formula: C₈H₅BrN₂O

Purity: Min. 95%

Molecular weight: 225.04 g/mol

Ref: 3D-SCA96712