CAS 67969-82-8
:Borate(1-), tetrafluoro-, hydrogen, compd. with 1,1′-oxybis[ethane] (1:1:1)
Description:
The chemical substance known as "Borate(1-), tetrafluoro-, hydrogen, compd. with 1,1′-oxybis[ethane] (1:1:1)" and identified by the CAS number 67969-82-8 is a complex boron compound. It features a borate anion with a tetrafluorinated structure, indicating the presence of four fluorine atoms bonded to the boron atom. The compound also includes a hydrogen atom, suggesting it may exhibit properties typical of hydrogen-borate complexes. The presence of 1,1′-oxybis[ethane] indicates that this compound is associated with a diethylene glycol ether, which can influence its solubility and reactivity. Generally, borate compounds are known for their applications in various fields, including materials science, agriculture, and as catalysts in chemical reactions. The tetrafluorinated nature of this borate may impart unique electronic and steric properties, making it of interest in specialized chemical applications. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require further investigation or experimental data for precise characterization.
Formula:C4H10O·BF4·H
InChI:InChI=1S/C4H10O.BF4/c1-3-5-4-2;2-1(3,4)5/h3-4H2,1-2H3;/q;-1/p+1
InChI key:InChIKey=JDQHPOVUCKSJFJ-UHFFFAOYSA-O
SMILES:[B+3]([F-])([F-])([F-])[F-].[H+].O(CC)CC
Synonyms:- Borate(1-), tetrafluoro-, hydrogen, compd. with 1,1′-oxybis[ethane] (1:1)
- Borate(1-), tetrafluoro-, hydrogen, compd. with 1,1′-oxybis[ethane] (1:1:1)
- Boron Hydrogen Fluoride - Ethoxyethane (1:1:4:1)
- Diethyl ether-tetrafluoroboric acid (1:1)
- Diethyloxonium Tetrafluoroborate
- Ethane, 1,1′-oxybis-, compd. with hydrogen tetrafluoroborate(1-) (1:1)
- Fluoroboric acid diethyl etherate
- Hydrogen tetrafluoroborate diethyl ether complex
- Tetrafluoroboric acid diethyl ether complex
- Tetrafluoroboric acid diethyl etherate
- Tetrafluoroboric acid etherate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Tetrafluoroboric acid-diethyl ether complex, 50-55% w/w HBF4
CAS:Tetrafluoroboric acid-diethyl ether acts as an effective catalyst used for various carbohydrate protection reactions. It is also used as a catalyst in the preparation of 4-fluoropiperidines by reaction between aldehydes and N-tosyl homoallylamine. This Thermo Scientific Chemicals brand product was o
Formula:C4H11BF4OColor and Shape:Colorless to brown, LiquidMolecular weight:161.93Tetrafluoroboric acid diethyl ether complex
CAS:Tetrafluoroboric acid diethyl ether complex
Formula:BF3·FH·(C2H5)2OColor and Shape: clear liquidMolecular weight:161.93g/molTetrafluoroboric acid-diethyl ether complex
CAS:Formula:C4H10BF4OColor and Shape:LiquidMolecular weight:161.9342


