CAS 6797-79-1
:4-Chloro-2-fluoro-1-iodobenzene
Description:
4-Chloro-2-fluoro-1-iodobenzene, with the CAS number 6797-79-1, is an aromatic halogenated compound characterized by the presence of three different halogen substituents on a benzene ring. Specifically, it features a chlorine atom at the para position, a fluorine atom at the meta position, and an iodine atom at the ortho position relative to each other. This compound is typically a colorless to pale yellow solid at room temperature and is known for its relatively low solubility in water but higher solubility in organic solvents. The presence of multiple halogens contributes to its unique reactivity, making it useful in various chemical synthesis processes, particularly in the fields of pharmaceuticals and agrochemicals. Additionally, the differing electronegativities of the halogens can influence the compound's electronic properties and reactivity, making it a subject of interest in studies related to substitution reactions and material science. Safety precautions should be observed when handling this compound due to the potential toxicity associated with halogenated aromatic compounds.
Formula:C6H3ClFI
InChI:InChI=1S/C6H3ClFI/c7-4-1-2-6(9)5(8)3-4/h1-3H
InChI key:InChIKey=RSTFBOIFYXJIMR-UHFFFAOYSA-N
SMILES:FC1=C(I)C=CC(Cl)=C1
Synonyms:- 2-Fluoro-4-chloroiodobenzene
- 4-Chloro-2-Fluoroiodobenzene
- Benzene, 4-chloro-2-fluoro-1-iodo-
- 4-Chloro-2-fluoro-1-iodobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Chloro-2-fluoro-1-iodobenzene, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3ClFIPurity:98%Color and Shape:Clear colorless to pale red to red to brown, LiquidMolecular weight:256.454-Chloro-2-fluoro-1-iodobenzene
CAS:Formula:C6H3ClFIPurity:98%Color and Shape:LiquidMolecular weight:256.44394-Chloro-2-fluoro-1-iodobenzene
CAS:Formula:C6H3ClFIPurity:>98.0%(GC)Color and Shape:White or Colorles to Yellow to Orange powder to lump to clear liquidMolecular weight:256.444-Chloro-2-fluoroiodobenzene
CAS:4-Chloro-2-fluoroiodobenzeneFormula:C6H3ClFIPurity:97%Color and Shape: light yellow liquidMolecular weight:256.44g/mol4-Chloro-2-fluoroiodobenzene
CAS:Formula:C6H3ClFIPurity:97%Color and Shape:LiquidMolecular weight:256.44




