CymitQuimica logo

CAS 6797-79-1

:

4-Chloro-2-fluoro-1-iodobenzene

Description:
4-Chloro-2-fluoro-1-iodobenzene, with the CAS number 6797-79-1, is an aromatic halogenated compound characterized by the presence of three different halogen substituents on a benzene ring. Specifically, it features a chlorine atom at the para position, a fluorine atom at the meta position, and an iodine atom at the ortho position relative to each other. This compound is typically a colorless to pale yellow solid at room temperature and is known for its relatively low solubility in water but higher solubility in organic solvents. The presence of multiple halogens contributes to its unique reactivity, making it useful in various chemical synthesis processes, particularly in the fields of pharmaceuticals and agrochemicals. Additionally, the differing electronegativities of the halogens can influence the compound's electronic properties and reactivity, making it a subject of interest in studies related to substitution reactions and material science. Safety precautions should be observed when handling this compound due to the potential toxicity associated with halogenated aromatic compounds.
Formula:C6H3ClFI
InChI:InChI=1S/C6H3ClFI/c7-4-1-2-6(9)5(8)3-4/h1-3H
InChI key:InChIKey=RSTFBOIFYXJIMR-UHFFFAOYSA-N
SMILES:FC1=C(I)C=CC(Cl)=C1
Synonyms:
  • 2-Fluoro-4-chloroiodobenzene
  • 4-Chloro-2-Fluoroiodobenzene
  • Benzene, 4-chloro-2-fluoro-1-iodo-
  • 4-Chloro-2-fluoro-1-iodobenzene
Found 6 products.