CAS 67973-32-4

3,5-Dibromo-4-methylbenzoic acid

Description:

3,5-Dibromo-4-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of two bromine atoms and a methyl group attached to a benzoic acid framework. The compound features a benzene ring substituted at the 3 and 5 positions with bromine atoms and at the 4 position with a methyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the bromine substituents can influence the compound's reactivity and stability, making it useful in synthetic organic chemistry and materials science. Safety precautions should be taken when handling this compound, as brominated compounds can pose health risks. Overall, 3,5-Dibromo-4-methylbenzoic acid is a valuable compound in research and industrial applications.

Formula: C₈H₆Br₂O₂

InChI: InChI=1S/C8H6Br2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=SJCBUASMFSRONS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(Br)=C(C)C(Br)=C1

Synonyms:

• 3,5-Dibromo-p-toluic acid
• 3,5-Dibromo-p-toluic acid (COOH=1)
• Benzoic acid, 3,5-dibromo-4-methyl-
• p-Toluic acid, 3,5-dibromo-
• 3,5-Dibromo-4-methylbenzoic acid

3,5-Dibromo-4-methylbenzoic acid

CAS: 67973-32-4

Formula: C₈H₆Br₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 293.9400

Ref: IN-DA003IL2

3,5-Dibromo-4-methylbenzoic acid

CAS: 67973-32-4

3,5-Dibromo-4-methylbenzoic acid

Formula: C₈H₆Br₂O₂

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 293.94g/mol

Ref: 54-OR11090

3,5-Dibromo-4-methylbenzoic acid

CAS: 67973-32-4

3,5-Dibromo-4-methylbenzoic acid is a high quality compound that is a useful intermediate in the synthesis of complex compounds. It has been used as a reagent in various chemical reactions and as a building block for the synthesis of other compounds. This compound may also be used as a speciality chemical or research chemical. 3,5-Dibromo-4-methylbenzoic acid can be used to synthesize many different types of compounds, including those with diverse functional groups.

Formula: C₈H₆Br₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 293.94 g/mol

Ref: 3D-FD70432

3,5-Dibromo-4-methylbenzoic acid

CAS: 67973-32-4

Formula: C₈H₆Br₂O₂

Purity: 97%

Molecular weight: 293.942

Ref: 10-F237410