CymitQuimica logo

CAS 679794-03-7

:

6-bromo-1-(phenylsulfonyl)-1H-indole

Description:
6-Bromo-1-(phenylsulfonyl)-1H-indole is a chemical compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position of the indole ring introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The phenylsulfonyl group attached to the nitrogen of the indole enhances the compound's solubility and may contribute to its pharmacological properties. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its unique structure allows for various interactions with biological molecules, making it a candidate for further research in therapeutic applications. Additionally, the presence of both bromine and sulfonyl groups suggests potential for diverse chemical reactivity, including electrophilic substitution and nucleophilic attack, which can be exploited in synthetic chemistry. Overall, 6-bromo-1-(phenylsulfonyl)-1H-indole represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C14H10BrNO2S
InChI:InChI=1/C14H10BrNO2S/c15-12-7-6-11-8-9-16(14(11)10-12)19(17,18)13-4-2-1-3-5-13/h1-10H
InChI key:NENPDYQYNRFWQU-UHFFFAOYSA-N
SMILES:c1ccc(cc1)S(=O)(=O)n1ccc2ccc(cc12)Br
Synonyms:
  • 1H-Indole, 6-bromo-1-(phenylsulfonyl)-
  • 6-Bromo-1-(phenylsulfonyl)indole
  • 6-Bromo-1-benzenesulphonylindole
  • T56 Bnj Bswr& He
  • 6-Bromo-1-(phenylsulfonyl)-1H-indole
  • 1-PHENYLSULFONYL-6-BROMOINDOLE
  • 1-Benzenesulfonyl-6-bromo-1H-indole
Found 5 products.