CAS 67984-20-7
:3,3'-Dimethyl-2,2'-bithiophenyl
Description:
3,3'-Dimethyl-2,2'-bithiophenyl is an organic compound characterized by its structure, which consists of two thiophene rings connected by a single bond, with methyl groups attached to the 3 positions of each thiophene. This compound is part of the bithiophene family, known for its applications in organic electronics, particularly in organic semiconductors and photovoltaic devices. The presence of methyl groups enhances its solubility and stability, making it suitable for various chemical reactions and applications. It typically exhibits good thermal stability and can display interesting electronic properties due to the conjugated system formed by the thiophene rings. Additionally, 3,3'-Dimethyl-2,2'-bithiophenyl may show photoluminescent properties, which can be advantageous in optoelectronic applications. Its synthesis often involves coupling reactions, and it can be characterized using techniques such as NMR spectroscopy and mass spectrometry. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C10H10S2
InChI:InChI=1/C10H10S2/c1-7-3-5-11-9(7)10-8(2)4-6-12-10/h3-6H,1-2H3
SMILES:Cc1ccsc1c1c(C)ccs1
Synonyms:- 3,3'-Dimethyl-2,2'-Bithiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,3'-Dimethyl-6H,6'H-2,2'-bithiopyran
CAS:Formula:C10H10S2Purity:97%Color and Shape:LiquidMolecular weight:194.31643,3'-Dimethyl-2,2'-bithiophene
CAS:3,3'-Dimethyl-2,2'-bithiophenePurity:97%Molecular weight:194.32g/mol3,3'-Dimethyl-2,2'-bithiophenyl
CAS:3,3'-Dimethyl-2,2'-bithiophenyl is a thermochromic polymeric compound that has been used as a colorant in polymers. The compound has a linear structure consisting of two thiophene rings with methyl groups at the 3 and 2 positions. The 3,3'-dimethyl group is attached to the second carbon atom of the thiophene ring and the 2,2'-bithiophenyl group is attached to the first carbon atom of the thiophene ring. The color changes from yellow to orange when heated to above 200 °C. This color change is due to conformational changes in the molecule that occur with thermal energy input.
Formula:C10H10S2Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:194.32 g/mol3,3′-Dimethyl-2,2′-bithiophenyl
CAS:Formula:C10H10S2Purity:97%Color and Shape:LiquidMolecular weight:194.31



