CymitQuimica logo

CAS 67992-45-4

:

2,3-dihydro-1H-indole-5,6-dione

Description:
2,3-Dihydro-1H-indole-5,6-dione, also known as indole-5,6-dione, is a bicyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features two carbonyl groups at the 5 and 6 positions of the indole ring, contributing to its reactivity and potential biological activity. It is typically a yellow to orange solid, and its solubility can vary depending on the solvent used. The presence of the carbonyl groups makes it susceptible to nucleophilic attack, allowing for various chemical transformations. 2,3-Dihydro-1H-indole-5,6-dione has garnered interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its derivatives may exhibit enhanced biological activity, making it a subject of research in drug development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C8H7NO2
InChI:InChI=1/C8H7NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h3-4,9H,1-2H2
SMILES:C1CNC2=CC(=O)C(=O)C=C12
Synonyms:
  • 1H-Indole-5,6-dione, 2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.