
CAS 68-76-8
:Triaziquone
Description:
Triaziquone, with the CAS number 68-76-8, is a chemical compound that belongs to the class of triazine derivatives. It is primarily recognized for its application in the field of agriculture, particularly as a herbicide. The compound exhibits a unique structure characterized by a triazine ring, which contributes to its biological activity. Triaziquone functions by inhibiting specific enzymatic pathways in plants, thereby disrupting their growth and development. It is typically used to control a variety of weeds in crops, enhancing agricultural productivity. The compound is known for its moderate toxicity to non-target organisms, necessitating careful handling and application to minimize environmental impact. Additionally, triaziquone is subject to regulatory scrutiny, and its use is governed by guidelines to ensure safety for both humans and ecosystems. Overall, its effectiveness as a herbicide, combined with its chemical stability, makes it a valuable tool in modern agricultural practices.
Formula:C12H13N3O2
InChI:InChI=1S/C12H13N3O2/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14/h7H,1-6H2
InChI key:InChIKey=PXSOHRWMIRDKMP-UHFFFAOYSA-N
SMILES:O=C1C(=C(C(=O)C=C1N2CC2)N3CC3)N4CC4
Synonyms:- 2,5-Cyclohexadiene-1,4-dione, 2,3,5-tris(1-aziridinyl)-
- p-Benzoquinone, 2,3,5-tris(1-aziridinyl)-
- 2,3,5-Tris(1-aziridinyl)-2,5-cyclohexadiene-1,4-dione
- p-Benzoquinone, tris(1-aziridinyl)-
- BAY 3231
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Triaziquone
CAS:Triaziquone is an alkylating agent that can react with DNA to form intrastrand crosslinks.Formula:C12H13N3O2Color and Shape:SolidMolecular weight:231.25
