CAS 68-81-5
:1,6-PHENAZINEDIOL5,10-DIOXIDE
Description:
1,6-Phenazinediol 5,10-dioxide, also known as phenazinedione, is a heterocyclic organic compound characterized by its phenazine structure, which consists of a fused ring system containing nitrogen atoms. This compound typically appears as a crystalline solid and is known for its potential applications in various fields, including pharmaceuticals and dyes. It exhibits properties such as being a strong oxidizing agent and can participate in redox reactions. The presence of hydroxyl groups contributes to its reactivity and solubility in polar solvents. Additionally, 1,6-phenazinediol 5,10-dioxide has been studied for its biological activities, including antimicrobial and antitumor properties. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is of interest in both synthetic chemistry and medicinal research due to its unique structural features and reactivity.
Formula:C12H8N2O4
InChI:InChI=1/C12H8N2O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15,18H
Synonyms:- Iodinin
- Crystalloiodine A
- 1,6-Phenadinediol 5,10-dioxide
- 1,6-Dihydroxyphenazine 5,10-dioxide
- 1,6-PHENAZINEDIOL5,10-DIOXIDE
- Iodinine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
