CAS 680-65-9
:diethyl difluoromalonate
Description:
Diethyl difluoromalonate is an organic compound characterized by its structure, which features two ethyl ester groups and two fluorine atoms attached to a malonate backbone. Its molecular formula is C8H10F2O4, indicating the presence of carbon, hydrogen, fluorine, and oxygen atoms. This compound is typically a colorless to pale yellow liquid with a fruity odor. Diethyl difluoromalonate is known for its reactivity, particularly in synthetic organic chemistry, where it serves as a versatile building block for the synthesis of various fluorinated compounds. The presence of fluorine atoms enhances its electrophilic character, making it useful in reactions such as nucleophilic substitutions and Michael additions. Additionally, it exhibits moderate solubility in organic solvents, which facilitates its use in various chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, diethyl difluoromalonate is a valuable compound in the field of fluorine chemistry and organic synthesis.
Formula:C6H8F4O
InChI:InChI=1/C6H8F4O/c1-2-3-11-4-6(9,10)5(7)8/h2,5H,1,3-4H2
SMILES:C=CCOCC(C(F)F)(F)F
Synonyms:- Difluoromalonic acid diethyl ester
- Diethyl 2,2-difluoromalonate
- Diethyl Difluoropropanedioate
- 3-(2,2,3,3-Tetrafluoropropoxy)Prop-1-Ene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Diethyl difluoromalonate, 97%
CAS:<p>Diethyl difluoromalonate is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legac</p>Formula:C7H10F2O4Purity:97%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:196.15Diethyl 2,2-difluoromalonate
CAS:Formula:C7H10F2O4Purity:95%Color and Shape:LiquidMolecular weight:196.1487Diethyl 2,2-difluoromalonate
CAS:<p>Diethyl 2,2-difluoromalonate</p>Formula:C7H10F2O4Purity:98%Color and Shape: colourless liquidMolecular weight:196.15g/molDiethyl difluoromalonate
CAS:Formula:C7H10F2O4Purity:96%Color and Shape:LiquidMolecular weight:196.15




