CAS 680208-82-6

6-amino-2-methyl-pyridine-3-carboxylic acid

Description:

6-Amino-2-methyl-pyridine-3-carboxylic acid, identified by its CAS number 680208-82-6, is an organic compound characterized by the presence of a pyridine ring substituted with an amino group and a carboxylic acid. This compound features a methyl group at the second position and an amino group at the sixth position of the pyridine ring, while the carboxylic acid is located at the third position. The presence of these functional groups imparts both basic and acidic properties to the molecule, making it potentially useful in various chemical reactions and applications, including pharmaceuticals and agrochemicals. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, and its structure suggests it may participate in hydrogen bonding. Additionally, the presence of the amino group can facilitate interactions with biological systems, which may be relevant for its potential use in medicinal chemistry. Overall, 6-amino-2-methyl-pyridine-3-carboxylic acid is a versatile compound with interesting chemical properties.

Formula: C₇H₈N₂O₂

InChI: InChI=1/C7H8N2O2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-3H,1H3,(H2,8,9)(H,10,11)

SMILES: Cc1c(ccc(=N)[nH]1)C(=O)O

Synonyms:

• 3-Pyridinecarboxylic Acid, 6-Amino-2-Methyl-
• 6-Amino-2-Methylnicotinic Acid

6-Amino-2-methylnicotinic acid

CAS: 680208-82-6

Formula: C₇H₈N₂O₂

Color and Shape: Solid

Molecular weight: 152.1506

Ref: IN-DA003A81

6-Amino-2-methylnicotinic acid

CAS: 680208-82-6

6-Amino-2-methylnicotinic acid

Purity: 95%

Molecular weight: 152.15g/mol

Ref: 54-OR16448

6-Amino-2-methylnicotinic acid

CAS: 680208-82-6

Purity: 95+%

Molecular weight: 152.1529999

Ref: 10-F720545