CAS 680215-64-9

2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid

Description:

2-Chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid is a synthetic organic compound characterized by its complex structure, which includes a propanoic acid backbone substituted with multiple halogen groups. The presence of two chlorine atoms and a trifluoromethyl group contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the trifluoromethyl group, which is known to enhance the metabolic stability of compounds. Additionally, the chlorinated phenyl ring may influence its reactivity and interactions with biological targets. Safety and handling precautions are essential, as halogenated compounds can pose environmental and health risks. Overall, 2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid represents a class of compounds with significant potential for research and application in various fields.

Formula: C₁₀H₇Cl₂F₃O₂

InChI: InChI=1/C10H7Cl2F3O2/c11-7-4-6(10(13,14)15)2-1-5(7)3-8(12)9(16)17/h1-2,4,8H,3H2,(H,16,17)

SMILES: c1cc(cc(c1CC(C(=O)O)Cl)Cl)C(F)(F)F

Synonyms:

• Benzenepropanoic Acid, Alpha,2-Dichloro-4-(Trifluoromethyl)-
• 2-CHLORO-3-[2-CHLORO-4-(TRIFLUOROMETHYL)PHENYL]PROPANOIC ACID
• Benzenepropanoic acid, α,2-dichloro-4-(trifluoromethyl)-

2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid

CAS: 680215-64-9

2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid

Purity: ≥95%

Molecular weight: 287.06g/mol

Ref: 54-PC32506