CAS 680215-65-0

α,2-Dichloro-N-(4-methoxyphenyl)-4-(trifluoromethyl)benzenepropanamide

Description:

α,2-Dichloro-N-(4-methoxyphenyl)-4-(trifluoromethyl)benzenepropanamide, with the CAS number 680215-65-0, is a synthetic organic compound characterized by its complex structure, which includes a dichloro substituent, a methoxyphenyl group, and a trifluoromethyl group. This compound typically exhibits a solid state at room temperature and is likely to be sparingly soluble in water due to its hydrophobic aromatic components. The presence of chlorine and trifluoromethyl groups suggests that it may possess significant lipophilicity, potentially influencing its biological activity and interactions with other molecules. Additionally, the methoxy group can enhance the compound's stability and reactivity. The compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its unique functional groups that can participate in various chemical reactions. Safety and handling precautions should be observed, as compounds with halogenated groups can exhibit toxicity and environmental persistence.

Formula: C₁₇H₁₄Cl₂F₃NO₂

InChI: InChI=1S/C17H14Cl2F3NO2/c1-25-13-6-4-12(5-7-13)23-16(24)15(19)8-10-2-3-11(9-14(10)18)17(20,21)22/h2-7,9,15H,8H2,1H3,(H,23,24)

InChI key: InChIKey=UBPFJIGGYXKDNK-UHFFFAOYSA-N

SMILES: C(C(C(NC1=CC=C(OC)C=C1)=O)Cl)C2=C(Cl)C=C(C(F)(F)F)C=C2

Synonyms:

• Benzenepropanamide, α,2-dichloro-N-(4-methoxyphenyl)-4-(trifluoromethyl)-
• α,2-Dichloro-N-(4-methoxyphenyl)-4-(trifluoromethyl)benzenepropanamide

2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]-N-(4-methoxyphenyl)propanamide

CAS: 680215-65-0

2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]-N-(4-methoxyphenyl)propanamide

Purity: ≥95%

Molecular weight: 392.20g/mol

Ref: 54-PC32510