CAS 680216-04-0

5-(2-chloro-1,1-dimethylethyl)-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole

Description:

5-(2-Chloro-1,1-dimethylethyl)-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole is a chemical compound characterized by its oxadiazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms and three carbon atoms. This compound features a chloro-substituted tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of a trifluoromethoxy group on the phenyl ring contributes to its electronic properties, making it a candidate for various applications in pharmaceuticals or agrochemicals. The compound's structure suggests it may exhibit significant interactions with biological targets due to the presence of halogen atoms, which can enhance binding affinity. Additionally, the oxadiazole moiety is known for its role in medicinal chemistry, often associated with antimicrobial and anti-inflammatory properties. Its stability, solubility, and reactivity would depend on the specific conditions and solvents used in experiments or applications. Overall, this compound represents a unique combination of functional groups that may offer diverse chemical behavior and potential utility in various fields.

Formula: C₁₃H₁₂ClF₃N₂O₂

InChI: InChI=1/C13H12ClF3N2O2/c1-12(2,7-14)11-18-10(19-21-11)8-3-5-9(6-4-8)20-13(15,16)17/h3-6H,7H2,1-2H3

SMILES: CC(C)(CCl)c1nc(c2ccc(cc2)OC(F)(F)F)no1

5-(2-Chloro-1,1-dimethylethyl)-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole

CAS: 680216-04-0

5-(2-Chloro-1,1-dimethylethyl)-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole

Purity: ≥95%

Molecular weight: 320.69g/mol

Ref: 54-PC32569