CAS 680216-24-4

4-chloro-2-(3-fluorobenzyl)-6-methyl-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione

Description:

4-Chloro-2-(3-fluorobenzyl)-6-methyl-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a pyrrolopyridine core. This compound features a chloro substituent at the 4-position and a fluorobenzyl group at the 2-position, contributing to its unique chemical properties and potential biological activity. The presence of the methyl group at the 6-position enhances its lipophilicity, which may influence its solubility and permeability in biological systems. As a diketone, it possesses two carbonyl functional groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its CAS number, 680216-24-4, allows for easy identification and retrieval of information regarding its synthesis, properties, and safety data. Overall, this compound exemplifies the intricate design often found in drug discovery and development.

Formula: C₁₅H₁₀ClFN₂O₂

InChI: InChI=1/C15H10ClFN2O2/c1-8-5-11-12(13(16)18-8)15(21)19(14(11)20)7-9-3-2-4-10(17)6-9/h2-6H,7H2,1H3

SMILES: Cc1cc2c(c(Cl)n1)C(=O)N(Cc1cccc(c1)F)C2=O

4-Chloro-2-(3-fluorobenzyl)-6-methyl-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione

CAS: 680216-24-4

4-Chloro-2-(3-fluorobenzyl)-6-methyl-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione

Purity: ≥95%

Molecular weight: 304.70g/mol

Ref: 54-PC32580