CAS 68027-14-5
:Hederacolchiside F
Description:
Hederacolchiside F, with the CAS number 68027-14-5, is a saponin compound primarily derived from the plant species of the genus Hedera, commonly known as ivy. Saponins are glycosides that possess both hydrophilic and hydrophobic properties, allowing them to form stable foams in aqueous solutions. This compound is characterized by its complex molecular structure, which typically includes a steroid or triterpenoid aglycone linked to one or more sugar moieties. Hederacolchiside F exhibits various biological activities, including potential anti-inflammatory, antioxidant, and antimicrobial properties, making it of interest in pharmacological research. Additionally, like other saponins, it may have hemolytic activity, which can be relevant in toxicological studies. Its solubility in water and ability to interact with cell membranes are also notable characteristics, influencing its bioavailability and efficacy in biological systems. Overall, Hederacolchiside F represents a fascinating area of study within natural product chemistry and its applications in health and medicine.
Formula:C65H106O31
InChI:InChI=1S/C65H106O31/c1-25-36(69)41(74)46(79)54(87-25)94-51-30(21-67)90-53(50(83)45(51)78)85-22-31-39(72)44(77)49(82)57(91-31)96-59(84)65-17-15-60(3,4)19-28(65)27-9-10-34-61(5)13-12-35(62(6,24-68)33(61)11-14-64(34,8)63(27,7)16-18-65)93-58-52(95-55-47(80)42(75)37(70)26(2)88-55)40(73)32(23-86-58)92-56-48(81)43(76)38(71)29(20-66)89-56/h9,25-26,28-58,66-83H,10-24H2,1-8H3/t25-,26-,28-,29+,30+,31+,32-,33+,34+,35-,36-,37-,38+,39+,40-,41+,42+,43-,44-,45+,46+,47+,48+,49+,50+,51+,52+,53+,54-,55-,56-,57-,58-,61-,62-,63+,64+,65-/m0/s1
InChI key:InChIKey=OTQUUEGQKWTQTA-FSPLGDHVSA-N
SMILES:C(O[C@@H]1O[C@H](CO[C@@H]2O[C@H](CO)[C@@H](O[C@H]3[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O3)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]45[C@](C=6[C@@](C)(CC4)[C@@]7(C)[C@](CC6)([C@]8(C)[C@@](CC7)([C@@](CO)(C)[C@@H](O[C@H]9[C@H](O[C@H]%10[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O%10)[C@@H](O)[C@@H](O[C@@H]%11O[C@H](CO)[C@@H](O)[C@H](O)[C@H]%11O)CO9)CC8)[H])[H])(CC(C)(C)CC5)[H]
Synonyms:- 3-O-α-L-Rhamnopyranosyl-(1→2)[β-D-glucopyranosyl(1→4)]-α-L-arabinopyranosylhederagenin 28-O-α-L-rhamnopyranosyl-(1→4)-β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside
- Hederacholichiside F
- Pulsatilla saponin H
- Hederacolchiside F
- Olean-12-en-28-oic acid, 3-[(O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→4)]-α-L-arabinopyranosyl)oxy]-23-hydroxy-, O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl ester, (3β,4α)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pulsatilla saponin H
CAS:<p>Pulsatilla saponin H is a natural product isolated from the Roots of Pulsatilla koreana.</p>Formula:C65H106O31Purity:98%Color and Shape:SolidMolecular weight:1383.52Pulsatillasaponin H
CAS:<p>Pulsatillasaponin H is a triterpenoid saponin, which is a secondary metabolite derived from plants in the Ranunculaceae family, specifically from the Pulsatilla genus. As part of the natural defense mechanisms of these plants, saponins such as Pulsatillasaponin H exhibit a unique mode of action characterized by their ability to disrupt cellular membranes through interaction with cholesterol and other sterols. This membrane disruption can lead to the initiation of cell apoptosis and modulation of immune responses.</p>Formula:C65H106O31Purity:Min. 95%Molecular weight:1,383.53 g/mol


