CAS 68027-81-6

Violaceol I

Description:

Violaceol I is a natural compound classified as a violet pigment, primarily derived from certain bacterial species, particularly those in the genus Chromobacterium. It is known for its distinctive violet color, which is attributed to its unique chemical structure that includes a complex polycyclic framework. This compound exhibits notable biological activities, including antimicrobial and antioxidant properties, making it of interest in various fields such as pharmaceuticals and food science. Violaceol I is soluble in organic solvents, which enhances its utility in different applications. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Additionally, research into Violaceol I has highlighted its potential as a natural dye and its role in ecological interactions, particularly in microbial communities. Overall, Violaceol I represents a fascinating subject of study due to its diverse applications and the intricate chemistry underlying its properties.

Formula: C₁₄H₁₄O₅

InChI: InChI=1S/C14H14O5/c1-7-3-9(15)13(17)11(5-7)19-12-6-8(2)4-10(16)14(12)18/h3-6,15-18H,1-2H3

InChI key: InChIKey=YRZXKRQRZJMBFT-UHFFFAOYSA-N

SMILES: O(C1=C(O)C(O)=CC(C)=C1)C2=C(O)C(O)=CC(C)=C2

Synonyms:

• 1,2-Benzenediol, 3,3′-oxybis[5-methyl-
• Ethericin A
• Aspermutarubol
• Violaceol I
• 3,3′-Oxybis[5-methyl-1,2-benzenediol]

Violaceol I

CAS: 68027-81-6

Violaceol I is a useful organic compound for research related to life sciences. The catalog number is T124415 and the CAS number is 68027-81-6.

Formula: C₁₄H₁₄O₅

Color and Shape: Solid

Molecular weight: 262.261

Ref: TM-T124415