
CAS 6803-19-6
:L-γ-Glutamyl-S-[(4-nitrophenyl)methyl]-L-cysteinylglycine
Description:
L-γ-Glutamyl-S-[(4-nitrophenyl)methyl]-L-cysteinylglycine, with the CAS number 6803-19-6, is a synthetic peptide that features a unique combination of amino acids, specifically glutamic acid, cysteine, and glycine, along with a nitrophenyl group. This compound is characterized by its peptide bond formation, which contributes to its stability and potential biological activity. The presence of the nitrophenyl moiety may impart specific optical properties and reactivity, making it useful in various biochemical applications, including as a substrate or inhibitor in enzyme assays. Additionally, the structure suggests potential interactions with biological systems, which could be explored for therapeutic or diagnostic purposes. Its solubility and stability in different solvents can vary, influencing its application in research and industry. Overall, this compound exemplifies the complexity of peptide chemistry and its relevance in biochemical research.
Formula:C17H22N4O8S
InChI:InChI=1S/C17H22N4O8S/c18-12(17(26)27)5-6-14(22)20-13(16(25)19-7-15(23)24)9-30-8-10-1-3-11(4-2-10)21(28)29/h1-4,12-13H,5-9,18H2,(H,19,25)(H,20,22)(H,23,24)(H,26,27)/t12-,13-/m0/s1
InChI key:InChIKey=OAWORKDPTSAMBZ-STQMWFEESA-N
SMILES:[C@H](NC(CC[C@@H](C(O)=O)N)=O)(CSCC1=CC=C(N(=O)=O)C=C1)C(NCC(O)=O)=O
Synonyms:- L-γ-Glutamyl-S-[(4-nitrophenyl)methyl]-L-cysteinylglycine
- Glycine, N-[N-L-γ-glutamyl-S-[(4-nitrophenyl)methyl]-L-cysteinyl]-
- Glutamine, N-[1-[(carboxymethyl)carbamoyl]-2-[(p-nitrobenzyl)thio]ethyl]-
- Glycine, L-γ-glutamyl-S-[(4-nitrophenyl)methyl]-L-cysteinyl-
- Glutamine, N-[1-[(carboxymethyl)carbamoyl]-2-[(p-nitrobenzyl)thio]ethyl]-, L-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S-(p-Nitrobenzyl)glutathione
CAS:S-(p-Nitrobenzyl)glutathione acts as a competitive inhibitor of glutathionase.Formula:C17H22N4O8SColor and Shape:SolidMolecular weight:442.44
