CAS 6804-12-2
:(5α,17β)-17-[(1-Oxoundecyl)oxy]androstan-3-one
Description:
The chemical substance known as "(5α,17β)-17-[(1-Oxoundecyl)oxy]androstan-3-one," with the CAS number 6804-12-2, is a synthetic steroid derivative. It features a steroid backbone typical of androgens, characterized by a four-ring carbon structure. The presence of the 1-oxoundecyl group indicates that it has a long aliphatic chain, which can influence its solubility and biological activity. This compound is likely to exhibit properties associated with anabolic steroids, potentially promoting muscle growth and enhancing physical performance. Its structural modifications may also affect its pharmacokinetics, including absorption, distribution, metabolism, and excretion. Additionally, the specific stereochemistry at the 5α and 17β positions is crucial for its interaction with androgen receptors, which can lead to various physiological effects. As with many synthetic steroids, it may have applications in medicine, particularly in hormone replacement therapies or treatments for certain medical conditions, but it may also be subject to regulatory scrutiny due to potential misuse in sports and bodybuilding.
Formula:C30H50O3
InChI:InChI=1S/C30H50O3/c1-4-5-6-7-8-9-10-11-12-28(32)33-27-16-15-25-24-14-13-22-21-23(31)17-19-29(22,2)26(24)18-20-30(25,27)3/h22,24-27H,4-21H2,1-3H3/t22-,24-,25-,26-,27-,29-,30-/m0/s1
InChI key:InChIKey=AOQIVBOEDICQDB-KNWHVVHCSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@H](OC(CCCCCCCCCC)=O)CC4)[H])(CC[C@]1(CC(=O)CC2)[H])[H])[H]
Synonyms:- (5α,17β)-17-[(1-Oxoundecyl)oxy]androstan-3-one
- Androstan-3-one, 17-[(1-oxoundecyl)oxy]-, (5α,17β)-
- Dihydrotestosterone undecanoate
- 5α-Dihydrotestosterone undecanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
5Alpha-Dihydro Testosterone Undecanoate
CAS:Controlled ProductApplications 5α-Dihydro Testosterone Undecanoate is a metabolite of Testosterone undecanoate.Controlled substance.
References Houwing, N., et al.: Pharmacother., 23, 1257 (2003), Carrillo, M., et al.: Brain Res., 1249, 118 (2009),Formula:C30H50O3Color and Shape:NeatMolecular weight:458.725α-Androstan-17β-ol-3-one Undecanoate-d21
CAS:Controlled ProductFormula:C30D21H29O3Color and Shape:NeatMolecular weight:479.865a-Dihydro Testosterone Undecanoate (1 mg/ml in Acetonitrile)
CAS:Controlled ProductFormula:C30H50O3Color and Shape:ColourlessMolecular weight:458.72
