CymitQuimica logo

CAS 6804-37-1

:

1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenoxy)phenoxy]benzene

Description:
1,2,3,4,5-Pentafluoro-6-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenoxy)phenoxy]benzene, with CAS number 6804-37-1, is a highly fluorinated organic compound characterized by its complex structure featuring multiple fluorine atoms attached to a benzene ring. This compound exhibits significant thermal and chemical stability due to the presence of fluorine, which enhances its resistance to degradation. The high electronegativity of fluorine contributes to unique properties such as low surface energy and hydrophobicity, making it useful in various applications, including as a surfactant or in coatings. Additionally, the presence of multiple phenoxy groups may impart specific functionalities, such as improved solubility in organic solvents. Its synthesis typically involves advanced organic chemistry techniques, and handling requires caution due to the potential environmental and health impacts associated with fluorinated compounds. Overall, this substance is of interest in materials science and chemical research, particularly in the development of advanced materials with specialized properties.
Formula:C18F14O2
InChI:InChI=1/C18F14O2/c19-1-3(21)7(25)15(8(26)4(1)22)33-17-11(29)13(31)18(14(32)12(17)30)34-16-9(27)5(23)2(20)6(24)10(16)28
InChI key:QUYRBEDFNGXEQH-UHFFFAOYSA-N
SMILES:c1(c(c(c(c(c1F)F)Oc1c(c(c(c(c1F)F)Oc1c(c(c(c(c1F)F)F)F)F)F)F)F)F)F
Found 1 products.