CAS 68047-07-4

1-[4-[2-(Dimethylamino)ethoxy]phenyl]-2-phenyl-1-butanone

Description:

1-[4-[2-(Dimethylamino)ethoxy]phenyl]-2-phenyl-1-butanone, identified by its CAS number 68047-07-4, is a synthetic organic compound characterized by its complex structure, which includes a butanone moiety and a dimethylamino group. This compound typically exhibits properties associated with ketones, such as being a polar solvent and having a relatively high boiling point compared to non-polar compounds. The presence of the dimethylamino group suggests potential basicity and the ability to participate in hydrogen bonding, which can influence its solubility in various solvents. Additionally, the phenyl groups contribute to its aromatic character, potentially affecting its reactivity and stability. This compound may be utilized in various applications, including pharmaceuticals and organic synthesis, due to its unique functional groups. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with exposure or environmental impact.

Formula: C₂₀H₂₅NO₂

InChI: InChI=1S/C20H25NO2/c1-4-19(16-8-6-5-7-9-16)20(22)17-10-12-18(13-11-17)23-15-14-21(2)3/h5-13,19H,4,14-15H2,1-3H3

InChI key: InChIKey=OBBFYFBJWYPOQQ-UHFFFAOYSA-N

SMILES: C(C(=O)C1=CC=C(OCCN(C)C)C=C1)(CC)C2=CC=CC=C2

Synonyms:

• 1-Butanone, 1-[4-[2-(Dimethylamino)Ethoxy]Phenyl]-2-Phenyl-
• 1-[4-[2-(Dimethylamino)ethoxy]phenyl]-2-phenyl-1-butanone
• Butyrophenone, 4′-[2-(dimethylamino)ethoxy]-2-phenyl-
• 1-{4-[2-(Dimethylamino)ethoxy]phenyl}-2-phenylbutan-1-one

Tamoxifen EP Impurity G

Controlled Product

CAS: 68047-07-4

Formula: C₂₀H₂₅NO₂

Color and Shape: Neat

Molecular weight: 311.42

Ref: 86-MM0053.07

Tamoxifen EP Impurity G

CAS: 68047-07-4

Formula: C₂₀H₂₅NO₂

Molecular weight: 311.43

Ref: 4Z-T-0118

Tamoxifen EP Impurity G

CAS: 68047-07-4

Formula: C₂₀H₂₅NO₂

Molecular weight: 311.42

Ref: ST-EA-CP-T40007