CymitQuimica logo

CAS 680569-83-9

:

6-chloro-1-methyl-1H-indole-2-carboxylic acid

Description:
6-Chloro-1-methyl-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 6-position and a carboxylic acid functional group at the 2-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indole derivatives are known for their biological activity. The compound may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest for synthetic organic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C10H8ClNO2
InChI:InChI=1/C10H8ClNO2/c1-12-8-5-7(11)3-2-6(8)4-9(12)10(13)14/h2-5H,1H3,(H,13,14)
InChI key:BMHTUBVXMTYFAS-UHFFFAOYSA-N
SMILES:Cn1c2cc(ccc2cc1C(=O)O)Cl
Synonyms:
  • 1H-indole-2-carboxylic acid, 6-chloro-1-methyl-
  • 6-chloro-1-methyl-1H-indole-2-carboxylic acid(SALTDATA: FREE)
  • 6-Chloro-1-methyl-1H-indole-2-carboxylic acid
Found 5 products.