CAS 680596-79-6
:8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dioxaspiro[4.5]dec-7-ene
Description:
The chemical substance known as "8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dioxaspiro[4.5]dec-7-ene" with the CAS number 680596-79-6 is characterized by its unique structural features, including a spirocyclic framework and a dioxaborolane moiety. The presence of the dioxaborolane group suggests potential applications in organic synthesis and materials science, particularly in the formation of boron-containing compounds. The spiro structure contributes to its rigidity and may influence its reactivity and interaction with other chemical species. This compound may exhibit interesting electronic properties due to the conjugation within the dioxaspiro system, which can affect its optical characteristics. Additionally, the bulky tetramethyl groups enhance its steric profile, potentially impacting solubility and reactivity. Overall, this compound represents a specialized class of organic molecules that may be of interest in various fields, including medicinal chemistry and polymer science, due to its distinctive structural and electronic properties.
Formula:C14H23BO4
InChI:InChI=1/C14H23BO4/c1-12(2)13(3,4)19-15(18-12)11-5-7-14(8-6-11)16-9-10-17-14/h5H,6-10H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(C2=CCC3(CC2)OCCO3)O1
Synonyms:- 1,4-Dioxaspiro[4,5]dec-7-en-8-boronic acid pinacol ester
- 1,4-Dioxaspiro[4,5]dec-7-en-8-boronicacidpinacolester
- T5Oxotj B-& Al6X Cutj D- Bt5Obotj D1 D1 E1 E1
- 1,4-Dioxa-Spiro[4,5]Dec-7-En-8-Boronic Acid, Pinacol Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,4-Dioxa-spiro[4,5]dec-7-en-8-boronic acid, pinacol ester
CAS:Formula:C14H23BO4Purity:97%Color and Shape:SolidMolecular weight:266.1410Ref: IN-DA0038HS
100mgTo inquire500gTo inquire250mg21.00€1g25.00€5g48.00€10g63.00€25g119.00€100g332.00€1,4-Dioxaspiro[4,5]dec-7-en-8-boronic acid, pinacol ester
CAS:1,4-Dioxaspiro[4,5]dec-7-en-8-boronic acid, pinacol esterFormula:C14H23BO4Purity:97%Color and Shape: off-white solidMolecular weight:266.14g/mol8-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dioxaspiro[4.5]dec-7-ene
CAS:Formula:C14H23BO4Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:266.144,4,5,5-Tetramethyl-2-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1,3,2-dioxaborolane
CAS:4,4,5,5-Tetramethyl-2-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1,3,2-dioxaborolane is a pinacol ester that can be polymerized to form polytetrafluoroethylene (PTFE). It has a high reactivity and is used as a monomer in the production of PTFE.Formula:C14H23BO4Purity:Min. 95%Color and Shape:PowderMolecular weight:266.14 g/mol4,4,5,5-Tetramethyl-2-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1,3,2-dioxaborolane
CAS:Formula:C14H23BO4Purity:98%Color and Shape:SolidMolecular weight:266.14




