CAS 680618-20-6
:5-(Formylamino)-1-naphthalenesulfonyl chloride
Description:
5-(Formylamino)-1-naphthalenesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a naphthalene ring, which contributes to its aromatic properties and potential applications in organic synthesis. The presence of the formylamino group indicates that it contains both an aldehyde and an amine, suggesting it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The sulfonyl chloride moiety is particularly useful in the synthesis of sulfonamides and other derivatives, making this compound valuable in medicinal chemistry and material science. Additionally, due to the presence of chlorine, it may exhibit properties such as increased reactivity towards nucleophiles. Safety precautions should be observed when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, 5-(Formylamino)-1-naphthalenesulfonyl chloride is a versatile intermediate in organic synthesis with potential applications in various fields.
Formula:C11H8ClNO3S
InChI:InChI=1S/C11H8ClNO3S/c12-17(15,16)11-6-2-3-8-9(11)4-1-5-10(8)13-7-14/h1-7H,(H,13,14)
InChI key:InChIKey=CINVSSZEEOERHL-UHFFFAOYSA-N
SMILES:N(C=O)C=1C2=C(C(S(Cl)(=O)=O)=CC=C2)C=CC1
Synonyms:- 5-(Formylamino)-1-naphthalenesulfonyl chloride
- 1-Naphthalenesulfonyl chloride, 5-(formylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(Formylamino)-1-naphthalenesulfonyl Chloride
CAS:Controlled ProductFormula:C11H8ClNO3SColor and Shape:NeatMolecular weight:269.704
