CAS 680618-21-7

3-(4-Pyridinylcarbonyl)benzenesulfonyl chloride

Description:

3-(4-Pyridinylcarbonyl)benzenesulfonyl chloride, with the CAS number 680618-21-7, is an organic compound characterized by the presence of both a sulfonyl chloride group and a pyridine moiety. This compound features a sulfonyl chloride functional group, which is known for its reactivity, particularly in nucleophilic substitution reactions. The pyridine ring contributes to the compound's aromaticity and can influence its electronic properties, making it a potential candidate for various chemical reactions, including acylation and sulfonylation. The presence of the carbonyl group adjacent to the pyridine enhances the electrophilicity of the sulfonyl chloride, facilitating its use in synthetic organic chemistry. Additionally, the compound may exhibit solubility in polar organic solvents, which is typical for sulfonyl chlorides. Its reactivity and structural features make it valuable in the synthesis of pharmaceuticals and agrochemicals, where it can serve as an intermediate or building block for more complex molecules. Safety precautions should be taken when handling this compound due to the corrosive nature of sulfonyl chlorides.

Formula: C₁₂H₈ClNO₃S

InChI: InChI=1S/C12H8ClNO3S/c13-18(16,17)11-3-1-2-10(8-11)12(15)9-4-6-14-7-5-9/h1-8H

InChI key: InChIKey=WHLZTVCJBMAWMC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(S(Cl)(=O)=O)=CC=C1)C=2C=CN=CC2

Synonyms:

• 3-(4-Pyridinylcarbonyl)benzenesulfonyl chloride
• Benzenesulfonyl chloride, 3-(4-pyridinylcarbonyl)-