CAS 680622-68-8
:6-(1-methylpyrrolidin-1-ium-1-yl)-3H-purin-2-amine chloride
Description:
6-(1-Methylpyrrolidin-1-ium-1-yl)-3H-purin-2-amine chloride, with the CAS number 680622-68-8, is a chemical compound that belongs to the class of purine derivatives. This substance features a purine core, which is a bicyclic structure composed of fused imidazole and pyrimidine rings, and is substituted with a 1-methylpyrrolidin-1-ium moiety, contributing to its unique properties. The presence of the chloride ion indicates that it is a salt, which can influence its solubility and stability in various solvents. The compound may exhibit biological activity, potentially interacting with nucleic acid structures or enzymes due to its purine-like structure. Its ionic nature suggests that it may be soluble in polar solvents, making it suitable for various applications in biochemical research or pharmaceutical development. As with many purine derivatives, it may play a role in cellular processes, signaling pathways, or as a potential therapeutic agent, although specific biological activities would require further investigation.
Formula:C10H15ClN6
InChI:InChI=1/C10H15N6.ClH/c1-16(4-2-3-5-16)9-7-8(13-6-12-7)14-10(11)15-9;/h6H,2-5H2,1H3,(H3,11,12,13,14,15);1H/q+1;/p-1
Synonyms:- 1-(2-Amino-7H-purin-6-yl)-1-methyl-pyrrolidinium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(2-Amino-1H-purin-6-yl)-1-methylpyrrolidinium chloride
CAS:Formula:C10H15ClN6Purity:95%Color and Shape:SolidMolecular weight:254.71931-(2-amino-7H-purin-6-yl)-1-methylpyrrolidin-1-ium chloride
CAS:Purity:≥95%Molecular weight:254.72000121-(2-Amino-7H-purin-6-yl)-1-methylpyrrolidinium Chloride
CAS:Controlled ProductStability Hygroscopic
Applications 1-(2-Amino-7H-purin-6-yl)-1-methylpyrrolidinium Chloride (cas# 680622-68-8) is a compound useful in organic synthesis.
References Pauly, G., et al.: J. Med. Chem., 51, 7144 (2008),Formula:C10H15N6·ClColor and Shape:NeatMolecular weight:254.72


